RHEA:10068          (APPROVED)

4-O-[(D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n UDP-alpha-D-glucose = 4-O-[(2-beta-D-glucosyl-D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n H(+) + n UDP

Last modified: 2019-11-04Chemically balanced: yes.

Formula: C79H132N2O29P4(C5H10O7P)n
Charge: (-4)(-1)n
(no structure available)
Formula: C15H22N2O17P2
Charge: -2
(no structure available)
Formula: C79H132N2O29P4(C11H20O12P)n
Charge: (-4)(-1)n
(no structure available)
Formula: H
Charge: 1
(no structure available)
Formula: C9H11N2O12P2
Charge: -3
(no structure available)

Same participants, different directions

RHEA:10069 4-O-[(D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n UDP-alpha-D-glucose => 4-O-[(2-beta-D-glucosyl-D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n H(+) + n UDP
RHEA:10070 4-O-[(2-beta-D-glucosyl-D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n H(+) + n UDP => 4-O-[(D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n UDP-alpha-D-glucose
RHEA:10071 4-O-[(D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n UDP-alpha-D-glucose <=> 4-O-[(2-beta-D-glucosyl-D-ribitylphospho)(n)-D-ribitylphospho-(2R)-glycerylphospho]-N-acetyl-beta-D-mannosaminyl-(1->4)-N-acetyl-alpha-D-glucosaminyl di-trans,octa-cis-undecaprenyl diphosphate + n H(+) + n UDP

Links to other resources

Enzymes Reactions

Reaction relationships

no data
no data

