RHEA:12845          (APPROVED)

[L-4-(L-arginin-2-N-yl)aspartate](n) + H2O = [L-4-(L-arginin-2-N-yl)aspartate](n-1) + L-4-(L-arginin-2-N-yl)aspartate

Last modified: 2019-12-09Chemically balanced: yes.

Formula: C20H36N10O9(C10H17N5O4)n-2
Charge: (0)(0)n-2
(no structure available)
+
Formula: H2O
Charge: 0
(no structure available)
=
Formula: C20H36N10O9(C10H17N5O4)n-3
Charge: (0)(0)n-3
(no structure available)
+
Formula: C10H19N5O5
Charge: 0
(no structure available)

Same participants, different directions

RHEA:12846 [L-4-(L-arginin-2-N-yl)aspartate](n) + H2O => [L-4-(L-arginin-2-N-yl)aspartate](n-1) + L-4-(L-arginin-2-N-yl)aspartate
RHEA:12847 [L-4-(L-arginin-2-N-yl)aspartate](n-1) + L-4-(L-arginin-2-N-yl)aspartate => [L-4-(L-arginin-2-N-yl)aspartate](n) + H2O
RHEA:12848 [L-4-(L-arginin-2-N-yl)aspartate](n) + H2O <=> [L-4-(L-arginin-2-N-yl)aspartate](n-1) + L-4-(L-arginin-2-N-yl)aspartate

Links to other resources

Enzymes Reactions

Reaction relationships

Outgoing
no data
Incoming
no data

Citations

Loading...