RHEA:23890          (APPROVED)

[L-4-(L-arginin-2-N-yl)aspartate](n+1) + ADP + H(+) + phosphate => [L-4-(L-arginin-2-N-yl)aspartate](n)-L-aspartate + ATP + L-arginine

Last modified: 2018-01-25Chemically balanced: yes.

Formula: C24H40N11O12(C10H17N5O4)n-2
Charge: (-1)(0)n-2
(no structure available)
+
Formula: C10H12N5O13P3
Charge: -4
(no structure available)
+
Formula: C6H15N4O2
Charge: 1
(no structure available)
<=
Formula: C20H36N10O9(C10H17N5O4)n-1
Charge: (0)(0)n-1
(no structure available)
+
Formula: C10H12N5O10P2
Charge: -3
(no structure available)
+
Formula: H
Charge: 1
(no structure available)
+
Formula: HO4P
Charge: -2
(no structure available)

Same participants, different directions

RHEA:23888 [L-4-(L-arginin-2-N-yl)aspartate](n)-L-aspartate + ATP + L-arginine = [L-4-(L-arginin-2-N-yl)aspartate](n+1) + ADP + H(+) + phosphate
RHEA:23889 [L-4-(L-arginin-2-N-yl)aspartate](n)-L-aspartate + ATP + L-arginine => [L-4-(L-arginin-2-N-yl)aspartate](n+1) + ADP + H(+) + phosphate
RHEA:23891 [L-4-(L-arginin-2-N-yl)aspartate](n)-L-aspartate + ATP + L-arginine <=> [L-4-(L-arginin-2-N-yl)aspartate](n+1) + ADP + H(+) + phosphate

Links to other resources

Enzymes Reactions

Reaction relationships

Outgoing
no data
Incoming
no data

Citations

Loading...